2'-Deoxy-2'-fluoro-N1-methylinosine
2'-Deoxy-2'-fluoro-N1-methylinosine is a highly potent antiviral nucleoside analog extensively employed in the biomedical sector, displays significant efficacy in combating viral infections, particularly those instigated by RNA viruses. Its proficiency in integrating into viral RNA culminates in the cessation of viral replication, thereby rendering it an efficacious therapeutic modality for diverse viral ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2376610-64-7 |
| Pricing | Inquire |
| Cas | 2376610-64-7 |
| Molecular Weight | 284.24 |
| Molecular Formula | C11H13FN4O4 |
| Canonical SMILES | CN1C=NC2=C(C1=O)N=CN2C3C(C(C(O3)CO)O)F |