3-(Trifluoromethyl)benzylzinc chloride solution
3-(Trifluoromethyl)benzylzinc chloride solution is used in the biomedical industry for its potential in the synthesis of various drugs. In addition, the solution’s active compound, 3-(Trifluoromethyl)benzylzinc chloride, has high reactivity, allowing it to effectively participate in organic reactions for drug synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 480438-42-4 |
| Pricing | Inquire |
| Cas | 480438-42-4 |
| Molecular Weight | 259.97 |
| Molecular Formula | F3CC6H4CH2ZnCl |
| Canonical SMILES | [CH2-]C1=CC(=CC=C1)C(F)(F)F.Cl[Zn+] |