Resorufin b-D-glucopyranoside
Resorufin b-D-glucopyranoside is an innovative compound product widely used in biomedical research for studying enzymes and disease mechanisms. This compound is a colorimetric substrate that undergoes enzymatic hydrolysis, releasing resorufin is a red fluorescent dye. It has been employed to detect and quantify β-glucosidase activity, leading to a better research for various metabolic disorders and neurodegenerative diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 101490-85-1 |
| Pricing | Inquire |
| Cas | 101490-85-1 |
| Molecular Weight | 375.33 |
| Molecular Formula | C18H17NO8 |
| Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |