Urotensin II (114-124), human
Urotensin II (human) is an endogenous peptide agonist for the urotensin-II receptor (EC50 = 0.1 nM). Urotensin II (human) increases calcium levels in a concentration-dependent manner in HEK293 cells expressing human UTR (EC50 = 0.6 nM), and causes arterio-selective vasoconstriction and vasodilatation in mammals in vitro and in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010654 |
| Pricing | Inquire |
| Cas | 251293-28-4 |
| Molecular Weight | 1388.57 |
| Molecular Formula | C64H85N13O18S2 |
| Canonical SMILES | CC(C)C(C(=O)O)NC(=O)C1CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)CCCCN)CC3=CNC4=CC=CC=C43)CC5=CC=CC=C5)NC(=O)C(CC(=O)O)NC(=O)C6CCCN6C(=O)C(C(C)O)NC(=O)C(CCC(=O)O)N |