5-O-benzoyl-1,2-isopropylidene-α-D-xylofuranose
5-O-benzoyl-1,2-isopropylidene-α-D-xylofuranose, a chemical compound with undeniable anti-tumor potential, presents itself as a treatment with impressive biological versatility. Boasting observed growth inhibition of various cancer cells, as well as promisingly broad-spectrum antimicrobial activity, this structurally unique molecule illuminates a hopeful path for biomedical advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6022-96-4 |
| Pricing | Inquire |
| Cas | 6022-96-4 |
| Molecular Weight | 294.30 |
| Molecular Formula | C15H18O6 |
| Canonical SMILES | CC1(OC2C(C(OC2O1)COC(=O)C3=CC=CC=C3)O)C |