3',5'-O-(Di-tert-butylsilanediyl)uridine
3',5'-O-(Di-tert-butylsilanediyl)uridine is a compound, emerging as an invaluable asset to the research of combating RNA-related afflictions. Performing dual duties, this compound serving as a precursor molecule for the research and development of bespoke nucleotides, thereby elevating RNA steadfastness and advancing RNA-centered therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 97219-04-0 |
| Pricing | Inquire |
| Cas | 97219-04-0 |
| Molecular Weight | 384.50 |
| Molecular Formula | C17H28N2O6Si |
| Canonical SMILES | CC(C)(C)[Si]1(OCC2C(O1)C(C(O2)N3C=CC(=O)NC3=O)O)C(C)(C)C |