2-Amino-b-L-arabinofurano[1,2:4,5]oxazoline
2-Amino-b-L-arabinofurano[1,2:4,5]oxazoline, a pivotal compound extensively employed in the biomedical industry, plays a fundamental role in elucidating intricate processes of carbohydrate metabolism and glycosylation reactions. Embracing its significance as a cornerstone, this compound exhilarates the synthesis of nucleoside analogs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35939-60-7 |
| Pricing | Inquire |
| Cas | 35939-60-7 |
| Molecular Weight | 174.15 |
| Molecular Formula | C6H10N2O4 |
| Canonical SMILES | C(C1C(C2C(O1)N=C(O2)N)O)O |