7'-O-(4,4'-Dimethoxytrityloxy)morpholinouracil
7'-O-(4,4'-Dimethoxytrityloxy)morpholinouracil arises as a formidable contender for tackling diverse cancer types. It manifests its potential by actively impeding specific enzymatic mechanisms and physiological pathways implicated in tumorigenesis. Evidencing remarkable efficacy, this remarkably versatile compound impedes the relentless expansion and reproduction of malignant cells.
Supplier | BOC Sciences |
---|---|
Product # | 1127343-02-5 |
Pricing | Inquire |
Cas | 1127343-02-5 |
Molecular Weight | 529.58 |
Molecular Formula | C30H31N3O6 |
Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4CNCC(O4)N5C=CC(=O)NC5=O |