5-Methoxy-3-(5-methoxyindol-3-yl)indole
5-Methoxy-3-(5-methoxyindol-3-yl)indole is an intermediate in the synthesis of metabolites of Melatonin (M215000), a hormone produced by the pineal gland in the vertebrate brain which affects the modulation of sleep patterns and circadian rhythms.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060175 |
| Pricing | Inquire |
| Cas | 916179-44-7 |
| Molecular Weight | 292.33 |
| Molecular Formula | C18H16N2O2 |
| Canonical SMILES | COC1=CC2=C(C=C1)NC=C2C3=CNC4=C3C=C(C=C4)OC |