4-Aminophenyl b-D-thioglucopyranoside
4-Aminophenyl b-D-thioglucopyranoside, a remarkable biomedicine, plays a vital role in the progress of diagnostic tools and therapeutic strategies within the scientific community. Demonstrating its prowess as a substrate analog, this compound exerts precise intervention by effectively subjugating β-D-glucosidase enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 58737-22-7 |
| Pricing | Inquire |
| Cas | 58737-22-7 |
| Molecular Weight | 287.33 |
| Molecular Formula | C12H17NO5S |
| Canonical SMILES | C1=CC(=CC=C1N)SC2C(C(C(C(O2)CO)O)O)O |