Friulimicin B
An antibiotic originally isolated from Actinoplanes friuliensis sp. HAG 010964. Friulimicin B has the activity of inhibiting the synthesis of peptidoglycan. It is a naturally occurring cyclic lipopeptide, with excellent activity against gram-positive pathogens through cell wall interruption, including multidrug-resistant strains.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01446 |
| Pricing | Inquire |
| Cas | 239802-15-4 |
| Molecular Weight | 1303.48 |
| Molecular Formula | C59H94N14O19 |
| Canonical SMILES | CC1C(C(=O)N2CCCCC2C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)N1)C(C)C)C(C)N)CC(=O)O)CC(=O)O)C(C)C(=O)O)NC(=O)C(CC(=O)N)NC(=O)CC=CCCCCCCCC(C)C |