S 14506 hydrochloride
S 14506 hydrochloride is a highly potent and selective 5-HT1A receptor full agonist (pKi = 9.0, 6.6, 7.5, 6.6 and < 6.0 for 5-HT1A, 5-HT1B, 5-HT1C, 5-HT2 and 5-HT3 receptors, respectively). S 14506 possibly binds between the agonist binding site and the G protein interaction switch site. S 14506 exhibits anxiolytic and antihypertensive properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 286369-38-8 |
| Pricing | Inquire |
| Cas | 286369-38-8 |
| Molecular Weight | 443.94 |
| Molecular Formula | C24H26FN3O2.HCl |
| Canonical SMILES | COC1=CC2=C(C=CC=C2N3CCN(CC3)CCNC(=O)C4=CC=C(C=C4)F)C=C1.Cl |