Destruxin B
Destruxin B, a cyclic hexadepsipeptide mycotoxin obtained from entomopathogenic fungi that has been found to exhibit insecticidal and phytotoxic effects and also be useful in studies of human non-small cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2503-26-6 |
| Pricing | Inquire |
| Cas | 2503-26-6 |
| Molecular Weight | 593.76 |
| Molecular Formula | C30H51N5O7 |
| Canonical SMILES | CCC(C)C1C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C(=O)N2CCCC2C(=O)N1)CC(C)C)C)C)C(C)C)C |