CDK4-IN-1
CDK 4/6 Inhibitor is a part of a group of compounds that exhibits selective inhibitory properties towards Cyclin-Dependent Kinases 4 & 6. These compounds are most commonly used to treat patients with breast cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1256963-02-6 |
| Pricing | Inquire |
| Cas | 1256963-02-6 |
| Molecular Weight | 440.97 |
| Molecular Formula | C22H29ClN8 |
| Canonical SMILES | CC(C)C1=C(C(=NN1)Cl)C2=NC(=NC=C2)NC3=NC=C(C=C3)N4CCC(CC4)N(C)C |