DMTr-3'-O-MOE-5-Me-rC(Bz)-2'-CE-Phosphoramidite
DMTr-3'-O-MOE-5-Me-rC(Bz)-2'-CE-Phosphoramidite is used in oligonucleotide synthesis and contains a 3'-O-methoxyethyl (MOE) group at the 3'-position of 5-methylcytidine (5-Me-rC), with benzoyl (Bz) protection on the cytosine amino group. Additionally, it features a cyanoethyl (CE) group at the 2'-end to facilitate efficient coupling reactions during solid-phase synthesis. It is employed to introduce modified 5-methylcytidine residues into RNA sequences, enhancing stability and target specificity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00618 |
| Pricing | Inquire |
| Cas | 1098233-10-3 |
| Molecular Weight | 922.03 |
| Molecular Formula | C50H60N5O10P |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OCCOC)OP(N(C(C)C)C(C)C)OCCC#N |