Resveratrol Impurity B
An impurity of Resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1610531-11-7 |
| Pricing | Inquire |
| Cas | 1610531-11-7 |
| Molecular Weight | 318.38 |
| Molecular Formula | C21H18O3 |
| Canonical SMILES | C1=CC=C(C=C1)CC2=C(C=C(C=C2O)C=CC3=CC=C(C=C3)O)O |