2',3',5'-Tri-O-benzoyl-4'-C-fluoroadenosine
2',3',5'-Tri-O-benzoyl-4'-C-fluoroadenosine, a nucleoside analog harnessed by the biomedical industry, offers a means to deduce the influence of fluoro-containing nucleosides on cellular function and metabolism. By impeding DNA replication and synthesis, it presents a promising strategy to curb cancer growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1000203-40-6 |
| Pricing | Inquire |
| Cas | 1000203-40-6 |
| Molecular Weight | 597.55 |
| Molecular Formula | C31H24FN5O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2(C(C(C(O2)N3C=NC4=C(N=CN=C43)N)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6)F |