PACAP-38 (28-38) (human, chicken, mouse, ovine, porcine, rat)
PACAP-38 (28-38) (human, chicken, mouse, ovine, porcine, rat) is distinguished as a bioactive peptide fragment. By binding and subsequently activating PAC1 receptors, it aids in the research of an array of ailments spanning neurodegenerative disorders to cardiovascular conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015187 |
| Pricing | Inquire |
| Cas | 160489-86-1 |
| Molecular Weight | 1403.68 |
| Molecular Formula | C61H110N24O14 |
| Canonical SMILES | CC(C)C(C(=O)NC(CCCCN)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)N)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)CN |