Docetaxel Impurity 1
A metabolite of Docetaxel, which is a semisynthetic derivative of Paclitaxel used to treat a variety of cancers, including breast, head and neck, stomach, prostate, and non-small cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 158810-73-2 |
| Pricing | Inquire |
| Cas | 158810-73-2 |
| Molecular Weight | 948.83 |
| Molecular Formula | C46H55Cl2NO16 |
| Canonical SMILES | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)OC(=O)OCC(Cl)Cl |