GNF-5
GNF-5 is the N-hydroxyethyl carboamide analog of GNF-2, a selective allosteric inhibitor of Bcr-Abl. GNF-5 demonstrates IC50 values of 4.52, 0.38, and 0.93 µM against Bcr-Abl mutants G250E, E255V, and M351T, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 778277-15-9 |
| Pricing | Inquire |
| Cas | 778277-15-9 |
| Molecular Weight | 418.38 |
| Molecular Formula | C20H17F3N4O3 |
| Canonical SMILES | C1=CC(=CC(=C1)C(=O)NCCO)C2=CC(=NC=N2)NC3=CC=C(C=C3)OC(F)(F)F |