Delta-8,9-Dehydro Estrone Sulfate Sodium Salt
A derivative of Estradiol. Estradiol​ is the major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female genotype in embryogenesis and at puberty.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61612-83-7 |
| Pricing | Inquire |
| Cas | 61612-83-7 |
| Molecular Weight | 370.40 |
| Molecular Formula | C18H19O5S Na |
| Canonical SMILES | CC12CCC3=C(C1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |