6-Raloxifene-β-D-glucopyranoside
6-Raloxifene-β-D-glucopyranoside, a derivative of raloxifene, is a selective and orally active estrogen receptor antagonist. It can be used to inhibit bone loss and resorption, and reduce lipid levels. (Extracted from patent US5567820A, compound Ia)
| Supplier | BOC Sciences |
|---|---|
| Product # | 334758-18-8 |
| Pricing | Inquire |
| Cas | 334758-18-8 |
| Molecular Weight | 635.72 |
| Molecular Formula | C34H37NO9S |
| Canonical SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)OC5C(C(C(C(O5)CO)O)O)O)C6=CC=C(C=C6)O |