2-Methylphenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Methylphenyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a compound of utmost importance in the biomedical sector, showcasing remarkable attributes as it participates in the intricate process of synthesizing therapeutic compounds against a plethora of ailments. This notable constituent assuming a pivotal function in the realm of pharmaceutical analysis by facilitating the meticulous investigation of distinct cellular mechanisms associated with malignancies, inflammatory reactions, and related maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 263746-45-8 |
| Pricing | Inquire |
| Cas | 263746-45-8 |
| Molecular Weight | 311.33 |
| Molecular Formula | C15H21NO6 |
| Canonical SMILES | CC1=CC=CC=C1OC2C(C(C(C(O2)CO)O)O)NC(=O)C |