2,3,5-Tri-O-benzyl-b-D-arabinofuranose
2,3,5-Tri-O-benzyl-b-D-arabinofuranose is a vital compound extensively used in the biomedicine industry. It acts as a key intermediate for the synthesis of various drugs targeting diseases like cancer, HIV, and viral infections. Its remarkable properties and versatility make it an indispensable component in the development of novel therapeutics aiming for improved patient outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60933-68-8 |
| Pricing | Inquire |
| Cas | 60933-68-8 |
| Molecular Weight | 420.50 |
| Molecular Formula | C26H28O5 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(O2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |