Dichloro[8-(di-tert-butylphosphinooxy)quinoline]palladium(II)
Dichloro[8-(di-tert-butylphosphinooxy)quinoline]palladium(II) is renowned for its profound biomedical catalytic capabilities and finds extensive application within the pharmaceutical realm. Its exceptional aptitude in myriad organic alterations renders it an indispensable entity for synthesizing an array of medicinal compounds. Evidencing considerable effectiveness, this intricate compound showcases pronounced efficiency in addressing afflictions encompassing cancer, inflammation, and neurodegenerative disorders. Functioning as a catalyst in numerous reactions, it seamlessly facilitates the generation of vital pharmaceutical elements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1100332-45-3 |
| Pricing | Inquire |
| Cas | 1100332-45-3 |
| Molecular Weight | 466.68 |
| Molecular Formula | C17H24Cl2NOPPd |
| Canonical SMILES | CC(C)(C)P(C(C)(C)C)OC1=CC=CC2=C1N=CC=C2.Cl[Pd]Cl |