N-Boc-3-(trifluoromethyl)aniline
N-Boc-3-(trifluoromethyl)aniline (CAS# 109134-07-8) is a reactant used in the preparation of transthyretin amyloidosis inhibitors containing carborane pharmacophores. It is also used in the design and synthesis of peripherally restricted transient receptor potential vanilloid 1 (TRPV1) antagonists.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB002382 |
| Pricing | Inquire |
| Cas | 109134-07-8 |
| Molecular Weight | 261.24 |
| Molecular Formula | C12H14F3NO2 |
| Canonical SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)C(F)(F)F |