2-Demethoxy-2-chloro Urapidil-[d4]
2-Demethoxy-2-chloro Urapidil-[d4], is the labelled analogue of 2-Demethoxy-2-chloro Urapidil, which is an impurity of Urapidil. Urapidil is a sympatholytic antihypertensive drug. It acts as an α1-adrenoceptor antagonist and as a 5-HT1A receptor agonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002056 |
| Pricing | Inquire |
| Cas | 1794883-40-1 |
| Molecular Weight | 395.92 |
| Molecular Formula | C19H22D4ClN5O2 |
| Canonical SMILES | CN1C(=CC(=O)N(C1=O)C)NCCCN2CCN(CC2)C3=CC=CC=C3Cl |