EV-A71-IN-1
EV-A71-IN-1 is a human enterovirus A71 (EV-A71) capsid protein inhibitor with an EC50 of 0.27 μM against EV-A71. EV-A71-IN-1 is a capsid binder that blocks the interaction between the viral VP1 and the host receptor hSCARB2. EV-A71-IN-1 inhibits a series of different human enteroviruses without significant cytotoxicity (CC50>56.2 μM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2413648-96-9 |
| Pricing | Inquire |
| Cas | 2413648-96-9 |
| Molecular Weight | 369.44 |
| Molecular Formula | C21H15N5S |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=NC(=CS3)C4=CN=C5N4C=CC=N5 |