Curromycin A
It is produced by the strain of Streptomyces hygroscipicus 358AV2. It has antibacterial activity against gram-positive bacteria such as Bacillus subtilis. It can inhibit the replication of human immunodeficiency virus (HIV), inhibit mouse melanoma B16 and leukemia P388 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01092 |
| Pricing | Inquire |
| Cas | 97412-76-5 |
| Molecular Weight | 713.87 |
| Molecular Formula | C38H55N3O10 |
| Canonical SMILES | CC1C(=O)N(C2(C1(C(CC(C)C(C=CC=CCNC(=O)C(C)(C)C(C(=CC=CC=CCC3=CN=C(O3)C)C)O)O)OC)O)C(OC2=O)COC)C |