5-Benzoyl-4-benzoyloxymethyl-1,2-O-isopropylidene-α-D-xylofuranose
5-Benzoyl-4-benzoyloxymethyl-1,2-O-isopropylidene-α-D-xylofuranose is a biomedical compound with benzoyl and isopropylidene components.This compound can be employed in pioneering approaches for disorders like cancer and diabetes. Capitalizing on its immense potential, it can be harnessed for drug conjugation, prodrug formulation, nanocarrier research and development, thereby elevating both the effectiveness and selectivity of drug therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 153914-97-7 |
| Pricing | Inquire |
| Cas | 153914-97-7 |
| Molecular Weight | 428.43 |
| Molecular Formula | C23H24O8 |
| Canonical SMILES | CC1(OC2C(C(OC2O1)(COC(=O)C3=CC=CC=C3)COC(=O)C4=CC=CC=C4)O)C |