4-Acetamidophenyl b-D-glucuronide methyl ester
4-Acetamidophenyl b-D-glucuronide methyl ester acts as a prodrug that undergoes hydrolysis to release the active moiety, a glucuronide metabolite. This metabolite exhibits analgesic and anti-inflammatory properties, making it beneficial for conditions such as arthritis and post-operative pain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 570394-17-1 |
| Pricing | Inquire |
| Cas | 570394-17-1 |
| Molecular Weight | 341.31 |
| Molecular Formula | C15H19NO8 |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)OC2C(C(C(C(O2)C(=O)OC)O)O)O |