Etamicastat HCl salt
Etamicastat HCl salt is a potent, peripherally selective, reversible, dopamine β-hydroxylase inhibitor (DBH inhibitor). It effectively decreases blood pressure, although does not prevent the development of hypertension in the spontaneously hypertensive rat. It was developed by Bial-Portela and was in clinic phase 2 trials, but now it is terminated.
| Supplier | BOC Sciences |
|---|---|
| Product # | 677773-32-9 |
| Pricing | Inquire |
| Cas | 677773-32-9 |
| Molecular Weight | 347.81 |
| Molecular Formula | C14H16ClF2N3OS |
| Canonical SMILES | FC1=CC(F)=C(OC[C@H](N2C(CCN)=CNC2=S)C3)C3=C1.[H]Cl |