Caffeic acid 3-O-b-D-glucopyranoside
Caffeic acid 3-O-b-D-glucopyranoside, an organic constituent abundant in diverse flora, exhibits promise as an antioxidant, anti-inflammatory, and anticancer agent. Within the realm of biomedical research, this compound assumes an integral role in the creation of therapeutics targeting cancer, cardiovascular ailments, and neurodegenerative afflictions. Additionally, its incorporation in skincare and cosmetic merchandise is advantageous due to its rejuvenating attributes and ability to safeguard the skin from harm.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24959-81-7 |
| Pricing | Inquire |
| Cas | 24959-81-7 |
| Molecular Weight | 342.30 |
| Molecular Formula | C15H18O9 |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)O)OC2C(C(C(C(O2)CO)O)O)O)O |