Dehydrocholic Acid
Dehydrocholic Acid is a derivative of Cholic Acid and manufactured by the oxidation of cholic acid. It is produced by choleretic and isolated from liver cells. It acts as a hydrocholeretic, increasing bile output to clear increased bile acid load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81-23-2 |
| Pricing | Inquire |
| Cas | 81-23-2 |
| Molecular Weight | 402.52 |
| Molecular Formula | C24H34O5 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(C(=O)CC3C2C(=O)CC4C3(CCC(=O)C4)C)C |