Potassium 4-(methylthio)phenyltrifluoroborate
Potassium 4-(methylthio)phenyltrifluoroborate is an indispensable compound in the biomedicine sector and exhibits immense potential as a key precursor for numerous pharmaceutical agents. Renowned for its distinctive attributes, it holds paramount significance in the advancement of therapeutic interventions targeting cancer, inflammation, and neurological afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 871231-43-5 |
| Pricing | Inquire |
| Cas | 871231-43-5 |
| Molecular Weight | 230.10 |
| Molecular Formula | C7H7BF3KS |
| Canonical SMILES | [B-](C1=CC=C(C=C1)SC)(F)(F)F.[K+] |