Ezetimibe Ring-Open Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L15) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1197811-72-5 |
| Pricing | Inquire |
| Cas | 1197811-72-5 |
| Molecular Weight | 411.45 |
| Molecular Formula | C24H23FNO3 |
| Canonical SMILES | C1=CC(=CC=C1CC(CCC(C2=CC=C(C=C2)F)O)C(=O)NC3=CC=C(C=C3)F)O |