3-Bromo-2-fluorobenzoic Acid
3-Bromo-2-fluorobenzoic Acid (CAS# 161957-56-8) is used as a reagent to synthesize Dabrafenib, an inhibitor of BRAF kinase that is used to treat BRAF V600-mutation positive carcinoma. BRAF is a gene that mediates cell growth and is activated by mutations caused by cancer. 3-Bromo-2-fluorobenzoic acid is also used as a reagent to prepare Alkynlphenoxyacetic acid receptor agonists, compounds that can be potentially used for the treatment of allergic inflammatory diseases (such as allergic rhinitis).
| Supplier | BOC Sciences |
|---|---|
| Product # | BB011801 |
| Pricing | Inquire |
| Cas | 161957-56-8 |
| Molecular Weight | 219.01 |
| Molecular Formula | C7H4BrFO2 |
| Canonical SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)O |