2-Nitrophenyldiazonium Chloride
2-Nitrophenyldiazonium Chloride is an intermediate in the synthesis of 2-(5-tert-Butyl-2-hydroxyphenyl)benzotriazole-d9 (B692907), a chemical reagent used in the synthesis of UV stabilizers in environmental waters.Used in the detection of UV light filters in sediment and sewage.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056665 |
| Pricing | Inquire |
| Cas | 119-66-4 |
| Molecular Weight | 185.57 |
| Molecular Formula | C6H4ClN3O2 |
| Canonical SMILES | C1=CC=C(C(=C1)[N+]#N)[N+](=O)[O-].[Cl-] |