Ethyl 2,3,4-tri-O-benzyl-b-D-thioglucopyranoside
Ethyl 2,3,4-tri-O-benzyl-b-D-thioglucopyranoside is a valuable compound used in biomedical research. It acts as a precursor for the synthesis of thioglucoside-based molecules, which have shown potential in the development of anti-cancer drugs. This compound plays a crucial role in studying the structure-activity relationship and designing new therapeutic agents targeting various diseases, particularly cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126461-54-9 |
| Pricing | Inquire |
| Cas | 126461-54-9 |
| Molecular Weight | 494.64 |
| Molecular Formula | C29H34O5S |
| Canonical SMILES | CCSC1C(C(C(C(O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |