ML 221
ML 221 is an apelin receptor antagonist with IC50 values of 0.70μM in a cAMP assay and 1.75 μM in β-arrestin assay. It has the potential to be used to treat or mediate the homeostasis of the cardiovascular system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 877636-42-5 |
| Pricing | Inquire |
| Cas | 877636-42-5 |
| Molecular Weight | 385.35 |
| Molecular Formula | C17H11N3O6S |
| Canonical SMILES | C1=CN=C(N=C1)SCC2=CC(=O)C(=CO2)OC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |