5-Methoxyisophthalic acid
5-Methoxyisophthalic acid (CAS# 46331-50-4) is a humic acid degradation product found in soil. 5-Methoxyisophthalic Acid is also used in the synthesis of mesophases formed by several homologs of achiral seven-ring bent-core compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 46331-50-4 |
| Pricing | Inquire |
| Cas | 46331-50-4 |
| Molecular Weight | 196.16 |
| Molecular Formula | C9H8O5 |
| Canonical SMILES | COC1=CC(=CC(=C1)C(=O)O)C(=O)O |