2,3:4,6-Di-O-isopropylidene-2-keto-L-gulonic acid sodium salt
2,3:4,6-Di-O-isopropylidene-2-keto-L-gulonic acid sodium salt, a pivotal bioactive compound extensively utilized in the biomedical sector, serves as a fundamental catalyst for the synthesis of L-ascorbic acid, widely recognized as vitamin C. This indispensable entity not only ensures the efficacious treatment of scurvy but also facilitates the augmentation of collagen synthesis while fortifying the immune system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52508-35-7 |
| Pricing | Inquire |
| Cas | 52508-35-7 |
| Molecular Weight | 296.25 |
| Molecular Formula | C12H17NaO7 |
| Canonical SMILES | CC1(OCC2C(O1)C3C(O2)(OC(O3)(C)C)C(=O)[O-])C.[Na+] |