G-5555
G-5555 is a selective PAK1 Inhibitor (Ki=3.7 nM) with low clearance (CLp = 3.4 mL/min/kg) and high oral bioavailability (F = 72%).
IC50: PAK2= 11 nM, SIK2= 9 mM, KHS1= 10 mM
IC50: PAK2= 11 nM, SIK2= 9 mM, KHS1= 10 mM
| Supplier | BOC Sciences |
|---|---|
| Product # | 1648863-90-4 |
| Pricing | Inquire |
| Cas | 1648863-90-4 |
| Molecular Weight | 492.96 |
| Molecular Formula | C25H25ClN6O3 |
| Canonical SMILES | CC1=CC=CC(=N1)C2=CC(=C(C=C2)C3=CC4=CN=C(N=C4N(C3=O)CC5OCC(CO5)N)NC)Cl |