6''-O-β-D-Apiofuranosylapterin
6''-O-β-D-Apiofuranosylapterin is a natural compound, holding immense promise in the research of specific ailments associated with folate insufficiency. Through serving as a preceding element to active folate cofactors, this natural compound facilitates the generation of pivotal enzymes crucial to diverse biological mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1057 |
| Pricing | Inquire |
| Cas | 2188162-94-7 |
| Molecular Weight | 556.51 |
| Molecular Formula | C25H32O14 |
| Canonical SMILES | CC(C)(C1C(C2=C(O1)C=CC3=C2OC(=O)C=C3)O)OC4C(C(C(C(O4)COC5C(C(CO5)(CO)O)O)O)O)O |