SARS-CoV-2-nsp13-IN-6
SARS-CoV-2 nsp13-IN-6 (compound C5) is a potent SARS-CoV-2 non-structural protein 13 (nsp13) inhibitor with IC50 values of 27 and 33 μM for ssDNA+ ATPase and ssDNA- ATPase. SARS-CoV-2 nsp13-IN-6 can be used for researching anti-COVID-19
| Supplier | BOC Sciences |
|---|---|
| Product # | 951588-85-5 |
| Pricing | Inquire |
| Cas | 951588-85-5 |
| Molecular Weight | 421.47 |
| Molecular Formula | C21H19N5O3S |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(S2)NC(=O)CN3C=NC4=C(C3=O)C=C5CCCCC5=N4 |