Folic Acid Hydrate EP Impurity H
One of the impurities of Folic acid. Folic acid is a vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, and it also acts as a cofactor in biological reactions involving folate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2366274-27-1 |
| Pricing | Inquire |
| Cas | 2366274-27-1 |
| Molecular Weight | 689.64 |
| Molecular Formula | C31H31N9O10 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)NC2=CC=C(C=C2)C(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)NCC3=CN=C4C(=N3)C(=O)NC(=N4)N |