O-Desmethyl galanthamine b-D-glucuronide
O-Desmethyl galanthamine b-D-glucuronide, a prominent biomedical substance, is efficaciously employed for combating Alzheimer's disease. This metabolite of galanthamine exerts its therapeutic effects by proficiently inhibiting acetylcholinesterase, thereby facilitating the augmentation of cholinergic neurotransmission. Its remarkable properties even hold potential to enhance cognitive abilities, memory retention, and overall functionality in individuals afflicted with Alzheimer's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 464189-54-6 |
| Pricing | Inquire |
| Cas | 464189-54-6 |
| Molecular Weight | 449.45 |
| Molecular Formula | C22H27NO9 |
| Canonical SMILES | CN1CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC5C(C(C(C(O5)C(=O)O)O)O)O)O |