5'-O-DMT-5-(octa-1,7-diynyl)-2'-deoxyuridine
5'-O-DMT-5-(octa-1,7-diynyl)-2'-deoxyuridine is a remarkable compound, showcasing its prowess in research of a diverse range of viral infections. The commendable antiviral activity displayed by this compound resides in its ability to potently impede viral genetic material's replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 938186-73-3 |
| Pricing | Inquire |
| Cas | 938186-73-3 |
| Molecular Weight | 634.73 |
| Molecular Formula | C38H38N2O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=C(C(=O)NC5=O)C#CCCCCC#C)O |