5'-DMT-3'-O-TBDMS-N1-Methyl-PseudoUridine
5'-DMT-3'-O-TBDMS-N1-Methyl-PseudoUridine, an essential compound in the field of biomedical research, holds immense significance for studying RNA modifications. Its role as a powerful tool in unraveling the impact of modified nucleosides on RNA structure and function is undeniable. Furthermore, its potential therapeutic implications in combating RNA dysregulation-associated ailments, such as cancer and neurodegenerative disorders, make it a promising avenue worth exploring.
| Supplier | BOC Sciences |
|---|---|
| Product # | 875302-43-5 |
| Pricing | Inquire |
| Cas | 875302-43-5 |
| Molecular Weight | 674.86 |
| Molecular Formula | C37H46N2O8Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(OC(C1O)C2=CN(C(=O)NC2=O)C)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |