TRIS[2-(3-MERCAPTOPROPIONYLOXY)ETHYL] ISOCYANURATE
TRIS[2-(3-Mercaptopropionyloxy)ethyl] isocyanurate is a versatile compound used in the biomedical industry. It acts as a crosslinking agent in the synthesis of biocompatible hydrogels for controlled drug release and tissue engineering applications. This product demonstrates excellent compatibility with various drugs and can be used to treat conditions such as localized infections, chronic wounds, and targeted drug delivery systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36196-44-8 |
| Pricing | Inquire |
| Cas | 36196-44-8 |
| Molecular Weight | 525.62 |
| Molecular Formula | C18H27N3O9S3 |
| Canonical SMILES | C(CS)C(=O)OCCN1C(=O)N(C(=O)N(C1=O)CCOC(=O)CCS)CCOC(=O)CCS |